Log In
Dolní Bory, Bory, Žďár nad Sázavou District, Vysočina Region, Czech Republici
| Regional Level Types | |
|---|---|
| Dolní Bory | Cadastral area |
| Bory | Municipality |
| Žďár nad Sázavou District | District |
| Vysočina Region | Region |
| Czech Republic | Country |
This page is currently not sponsored. Click here to sponsor this page.
Get Involved with mindat.org
Mindat.org has grown through countless contributions from mineral enthusiasts, collectors, researchers and experts around the world — people just like you.
Want to take part?
1
2
3
4
Contribute
Add photos, locality information and knowledge
Every contribution helps make mindat.org better for everyone.
Neighbouring regions:
Type:
Other/historical names associated with this locality:
Unter Borry; Moravské Bory
Name(s) in local language(s):
Dolní Bory (Hatě; Unter Bory; Unter Borry)
Dolní Bory (German Unter Borry, formerly Moravské Bory) is the northwestern part of the village Bory in the district of Žďár nad Sázavou.
Dolní Bory is also the name of a cadastral area with an area of 10.55 km².
Granite pegmatites in Hatě near Dolní Bory are situated in the Moldanubian complex of the Bohemian Massif, on the northern border of the Bory granulite massif. All the greater pegmatite dykes strike in nearly the same direction towards NNW-SSE and the dip of 50–60 degrees towards ENE. Some dykes are more than 1 km long and from several metres up to 30 m thick. The pegmatites show a concentric zoning.
There are three types of pegmatites in this area:
(i) Symmetrically zoned barren pegmatite dikes with schorl, muscovite, apatite and locally also with andalusite and sekaninaite;
(ii) phosphate-bearing pegmatites characterized by the presence of primary Fe,Mn-phosphates;
(iii) The most evolved lepidolite-subtype pegmatites with abundant elbaite, locally amblygonite-montebrazite, cookeite and spodumene+quartz pseudomorphs after petalite.
All these pegmatites have geochemical characteristics indicating a LCT affiliation.
Pegmatites were mined for feldspar, mining closed since the early 1970s. Dumps are recultivated and replanted with conifers. Trespassing in the mining area is prohibited and is not welcomed by the forestry service.
Only significant pegmatite veins are listed as sub-localities. Most of the minerals were found on dumps, so it is hard to link them with specific pegmatite bodies.
Dolní Bory is also the name of a cadastral area with an area of 10.55 km².
Granite pegmatites in Hatě near Dolní Bory are situated in the Moldanubian complex of the Bohemian Massif, on the northern border of the Bory granulite massif. All the greater pegmatite dykes strike in nearly the same direction towards NNW-SSE and the dip of 50–60 degrees towards ENE. Some dykes are more than 1 km long and from several metres up to 30 m thick. The pegmatites show a concentric zoning.
There are three types of pegmatites in this area:
(i) Symmetrically zoned barren pegmatite dikes with schorl, muscovite, apatite and locally also with andalusite and sekaninaite;
(ii) phosphate-bearing pegmatites characterized by the presence of primary Fe,Mn-phosphates;
(iii) The most evolved lepidolite-subtype pegmatites with abundant elbaite, locally amblygonite-montebrazite, cookeite and spodumene+quartz pseudomorphs after petalite.
All these pegmatites have geochemical characteristics indicating a LCT affiliation.
Pegmatites were mined for feldspar, mining closed since the early 1970s. Dumps are recultivated and replanted with conifers. Trespassing in the mining area is prohibited and is not welcomed by the forestry service.
Only significant pegmatite veins are listed as sub-localities. Most of the minerals were found on dumps, so it is hard to link them with specific pegmatite bodies.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities97 valid minerals. 1 (TL) - type locality of valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series' | 4.. | |
| ⓘ | 'var. Wolframoixiolite' | 4.. | (Nb,W,Ta,Fe,Mn)2O4 |
| ⓘ | Hercynite | 4.BB.05 | Fe2+Al2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Rose Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | var. Niobium-bearing Rutile | 4.DB.05 | (Ti,Nb)O2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Molybdite | 4.E0.10 | MoO3 |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Halotrichite | 7.CB.85 | Fe2+Al2(SO4)4 · 22H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Triphylite | 8.AB.10 | LiFe2+PO4 |
| ⓘ | Sarcopside | 8.AB.15 | Fe2+3(PO4)2 |
| ⓘ | Beusite | 8.AB.20 | Mn2+Mn2+2 (PO4)2 |
| ⓘ | Graftonite | 8.AB.20 | Fe2+Fe2+2(PO4)2 |
| ⓘ | Alluaudite | 8.AC.10 | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| ⓘ | Pretulite | 8.AD.35 | Sc(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Amblygonite | 8.BB.05 | LiAl(PO4)F |
| ⓘ | Montebrasite | 8.BB.05 | LiAl(PO4)(OH) |
| ⓘ | Triplite | 8.BB.10 | Mn2+2(PO4)F |
| ⓘ | Zwieselite | 8.BB.10 | Fe2+2(PO4)F |
| ⓘ | Wagnerite | 8.BB.15 | Mg2(PO4)F |
| ⓘ | Scorzalite | 8.BB.40 | Fe2+Al2(PO4)2(OH)2 |
| ⓘ | Rockbridgeite | 8.BC.10 | (Fe2+0.5Fe3+0.5)2Fe3+3(PO4)3(OH)5 |
| ⓘ | Augelite | 8.BE.05 | Al2(PO4)(OH)3 |
| ⓘ | Brazilianite | 8.BK.05 | NaAl3(PO4)2(OH)4 |
| ⓘ | Gorceixite | 8.BL.10 | BaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Parasymplesite | 8.CE.40 | Fe2+3(AsO4)2 · 8H2O |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ | Symplesite | 8.CE.45 | Fe2+3(AsO4)2 · 8H2O |
| ⓘ | Fairfieldite | 8.CG.05 | Ca2Mn2+(PO4)2 · 2H2O |
| ⓘ | Pitticite | 8.DB.05 | (Fe, AsO4, H2O) (?) |
| ⓘ | Earlshannonite | 8.DC.15 | Mn2+Fe3+2(PO4)2(OH)2 · 4H2O |
| ⓘ | Whitmoreite | 8.DC.15 | Fe2+Fe3+2(PO4)2(OH)2 · 4H2O |
| ⓘ | Strunzite | 8.DC.25 | Mn2+Fe3+2(PO4)2(OH)2 · 6H2O |
| ⓘ | Beraunite | 8.DC.27 | Fe3+6(PO4)4O(OH)4 · 6H2O |
| ⓘ | Laueite | 8.DC.30 | Mn2+Fe3+2(PO4)2(OH)2 · 8H2O |
| ⓘ | Cacoxenite | 8.DC.40 | Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| ⓘ | Paulkerrite | 8.DH.35 | K(Mg,Mn2+)2(Fe3+,Al,Ti,Mg)2Ti(PO4)4(OH)3 · 15H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ | Meta-autunite | 8.EB.10 | Ca(UO2)2(PO4)2 · 6H2O |
| ⓘ | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | var. Oyamalite | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Chloritoid | 9.AF.85 | Fe2+Al2O(SiO4)(OH)2 |
| ⓘ | Dumortierite | 9.AJ.10 | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Sekaninaite (TL) | 9.CJ.10 | Fe2+2Al4Si5O18 |
| ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Foitite | 9.CK.05 | ◻(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Spodumene | 9.DA.30 | LiAlSi2O6 |
| ⓘ | Ferro-anthophyllite ? | 9.DD.05 | ◻Fe2+2Fe2+5(Si8O22)(OH)2 |
| ⓘ | Ferro-gedrite | 9.DD.05 | ◻Fe2+2(Fe2+3Al2)(Al2Si6O22)(OH)2 |
| ⓘ | Pyrophyllite | 9.EC.10 | Al2Si4O10(OH)2 |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Siderophyllite | 9.EC.20 | KFe2+2Al(Al2Si2O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Nontronite | 9.EC.40 | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Cookeite | 9.EC.55 | (LiAl4◻)[AlSi3O10](OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Berthierine | 9.ED.15 | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| ⓘ | Palygorskite | 9.EE.20 | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ⓘ | Petalite | 9.EF.05 | LiAl(Si4O10) |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Siderogel' | - | ~FeO(OH) · nH2O |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Xanthoxenite (of Laubmann and Steinmetz)' | - | |
| ⓘ | 'Manganomelane' | - | |
| ⓘ | 'Xenotime' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Jahnsite Group' | - | XM1M22M32(H2O)8(OH)2(PO4)4 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Augelite | Al2(PO4)(OH)3 |
| H | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| H | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brazilianite | NaAl3(PO4)2(OH)4 |
| H | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| H | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| H | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Earlshannonite | Mn2+Fe23+(PO4)2(OH)2 · 4H2O |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
| H | ⓘ Ferro-anthophyllite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| H | ⓘ Ferro-gedrite | ◻Fe22+(Fe32+Al2)(Al2Si6O22)(OH)2 |
| H | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Laueite | Mn2+Fe23+(PO4)2(OH)2 · 8H2O |
| H | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| H | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | ⓘ Montebrasite | LiAl(PO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| H | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| H | ⓘ Paulkerrite | K(Mg,Mn2+)2(Fe3+,Al,Ti,Mg)2Ti(PO4)4(OH)3 · 15H2O |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| H | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| H | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| H | ⓘ Siderogel | ~FeO(OH) · nH2O |
| H | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| H | ⓘ Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| H | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | ⓘ Whitmoreite | Fe2+Fe23+(PO4)2(OH)2 · 4H2O |
| H | ⓘ Jahnsite Group | XM1M22M32(H2O)8(OH)2(PO4)4 |
| Li | Lithium | |
| Li | ⓘ Amblygonite | LiAl(PO4)F |
| Li | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Montebrasite | LiAl(PO4)(OH) |
| Li | ⓘ Petalite | LiAl(Si4O10) |
| Li | ⓘ Spodumene | LiAlSi2O6 |
| Li | ⓘ Triphylite | LiFe2+PO4 |
| B | Boron | |
| B | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| O | ⓘ Amblygonite | LiAl(PO4)F |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Augelite | Al2(PO4)(OH)3 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| O | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| O | ⓘ Beusite | Mn2+Mn22+ (PO4)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brazilianite | NaAl3(PO4)2(OH)4 |
| O | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| O | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| O | ⓘ Earlshannonite | Mn2+Fe23+(PO4)2(OH)2 · 4H2O |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
| O | ⓘ Ferro-anthophyllite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Ferro-gedrite | ◻Fe22+(Fe32+Al2)(Al2Si6O22)(OH)2 |
| O | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Graftonite | Fe2+Fe22+(PO4)2 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hercynite | Fe2+Al2O4 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series | |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Laueite | Mn2+Fe23+(PO4)2(OH)2 · 8H2O |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| O | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Molybdite | MoO3 |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Montebrasite | LiAl(PO4)(OH) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| O | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| O | ⓘ Paulkerrite | K(Mg,Mn2+)2(Fe3+,Al,Ti,Mg)2Ti(PO4)4(OH)3 · 15H2O |
| O | ⓘ Petalite | LiAl(Si4O10) |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| O | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sarcopside | Fe32+(PO4)2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| O | ⓘ Sekaninaite | Fe22+Al4Si5O18 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Siderogel | ~FeO(OH) · nH2O |
| O | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spodumene | LiAlSi2O6 |
| O | ⓘ Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| O | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Triphylite | LiFe2+PO4 |
| O | ⓘ Triplite | Mn22+(PO4)F |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Wagnerite | Mg2(PO4)F |
| O | ⓘ Whitmoreite | Fe2+Fe23+(PO4)2(OH)2 · 4H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zwieselite | Fe22+(PO4)F |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Pretulite | Sc(PO4) |
| O | ⓘ Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series var. Wolframoixiolite | (Nb,W,Ta,Fe,Mn)2O4 |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Zircon var. Oyamalite | Zr(SiO4) |
| O | ⓘ Jahnsite Group | XM1M22M32(H2O)8(OH)2(PO4)4 |
| F | Fluorine | |
| F | ⓘ Amblygonite | LiAl(PO4)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Triplite | Mn22+(PO4)F |
| F | ⓘ Wagnerite | Mg2(PO4)F |
| F | ⓘ Zwieselite | Fe22+(PO4)F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Na | ⓘ Brazilianite | NaAl3(PO4)2(OH)4 |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Mg | ⓘ Paulkerrite | K(Mg,Mn2+)2(Fe3+,Al,Ti,Mg)2Ti(PO4)4(OH)3 · 15H2O |
| Mg | ⓘ Wagnerite | Mg2(PO4)F |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Amblygonite | LiAl(PO4)F |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Augelite | Al2(PO4)(OH)3 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Brazilianite | NaAl3(PO4)2(OH)4 |
| Al | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Al | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Al | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Ferro-gedrite | ◻Fe22+(Fe32+Al2)(Al2Si6O22)(OH)2 |
| Al | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| Al | ⓘ Hercynite | Fe2+Al2O4 |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Montebrasite | LiAl(PO4)(OH) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Al | ⓘ Paulkerrite | K(Mg,Mn2+)2(Fe3+,Al,Ti,Mg)2Ti(PO4)4(OH)3 · 15H2O |
| Al | ⓘ Petalite | LiAl(Si4O10) |
| Al | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| Al | ⓘ Sekaninaite | Fe22+Al4Si5O18 |
| Al | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spodumene | LiAlSi2O6 |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Si | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Ferro-anthophyllite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| Si | ⓘ Ferro-gedrite | ◻Fe22+(Fe32+Al2)(Al2Si6O22)(OH)2 |
| Si | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Si | ⓘ Petalite | LiAl(Si4O10) |
| Si | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sekaninaite | Fe22+Al4Si5O18 |
| Si | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spodumene | LiAlSi2O6 |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Zircon var. Oyamalite | Zr(SiO4) |
| P | Phosphorus | |
| P | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| P | ⓘ Amblygonite | LiAl(PO4)F |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Augelite | Al2(PO4)(OH)3 |
| P | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| P | ⓘ Beusite | Mn2+Mn22+ (PO4)2 |
| P | ⓘ Brazilianite | NaAl3(PO4)2(OH)4 |
| P | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| P | ⓘ Earlshannonite | Mn2+Fe23+(PO4)2(OH)2 · 4H2O |
| P | ⓘ Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
| P | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Graftonite | Fe2+Fe22+(PO4)2 |
| P | ⓘ Laueite | Mn2+Fe23+(PO4)2(OH)2 · 8H2O |
| P | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| P | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Montebrasite | LiAl(PO4)(OH) |
| P | ⓘ Paulkerrite | K(Mg,Mn2+)2(Fe3+,Al,Ti,Mg)2Ti(PO4)4(OH)3 · 15H2O |
| P | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| P | ⓘ Sarcopside | Fe32+(PO4)2 |
| P | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| P | ⓘ Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Triphylite | LiFe2+PO4 |
| P | ⓘ Triplite | Mn22+(PO4)F |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | ⓘ Wagnerite | Mg2(PO4)F |
| P | ⓘ Whitmoreite | Fe2+Fe23+(PO4)2(OH)2 · 4H2O |
| P | ⓘ Zwieselite | Fe22+(PO4)F |
| P | ⓘ Pretulite | Sc(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| P | ⓘ Jahnsite Group | XM1M22M32(H2O)8(OH)2(PO4)4 |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Paulkerrite | K(Mg,Mn2+)2(Fe3+,Al,Ti,Mg)2Ti(PO4)4(OH)3 · 15H2O |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Sc | Scandium | |
| Sc | ⓘ Pretulite | Sc(PO4) |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Paulkerrite | K(Mg,Mn2+)2(Fe3+,Al,Ti,Mg)2Ti(PO4)4(OH)3 · 15H2O |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| Mn | Manganese | |
| Mn | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Mn | ⓘ Beusite | Mn2+Mn22+ (PO4)2 |
| Mn | ⓘ Earlshannonite | Mn2+Fe23+(PO4)2(OH)2 · 4H2O |
| Mn | ⓘ Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
| Mn | ⓘ Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series | |
| Mn | ⓘ Laueite | Mn2+Fe23+(PO4)2(OH)2 · 8H2O |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Paulkerrite | K(Mg,Mn2+)2(Fe3+,Al,Ti,Mg)2Ti(PO4)4(OH)3 · 15H2O |
| Mn | ⓘ Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| Mn | ⓘ Triplite | Mn22+(PO4)F |
| Mn | ⓘ Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series var. Wolframoixiolite | (Nb,W,Ta,Fe,Mn)2O4 |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| Fe | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Fe | ⓘ Earlshannonite | Mn2+Fe23+(PO4)2(OH)2 · 4H2O |
| Fe | ⓘ Ferro-anthophyllite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Ferro-gedrite | ◻Fe22+(Fe32+Al2)(Al2Si6O22)(OH)2 |
| Fe | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Graftonite | Fe2+Fe22+(PO4)2 |
| Fe | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hercynite | Fe2+Al2O4 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series | |
| Fe | ⓘ Laueite | Mn2+Fe23+(PO4)2(OH)2 · 8H2O |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| Fe | ⓘ Paulkerrite | K(Mg,Mn2+)2(Fe3+,Al,Ti,Mg)2Ti(PO4)4(OH)3 · 15H2O |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| Fe | ⓘ Sarcopside | Fe32+(PO4)2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| Fe | ⓘ Sekaninaite | Fe22+Al4Si5O18 |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Siderogel | ~FeO(OH) · nH2O |
| Fe | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Fe | ⓘ Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| Fe | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| Fe | ⓘ Triphylite | LiFe2+PO4 |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Whitmoreite | Fe2+Fe23+(PO4)2(OH)2 · 4H2O |
| Fe | ⓘ Zwieselite | Fe22+(PO4)F |
| Fe | ⓘ Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series var. Wolframoixiolite | (Nb,W,Ta,Fe,Mn)2O4 |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Cu | Copper | |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Zr | ⓘ Zircon var. Oyamalite | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Nb | ⓘ Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series var. Wolframoixiolite | (Nb,W,Ta,Fe,Mn)2O4 |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Nb | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Molybdite | MoO3 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Ba | Barium | |
| Ba | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ta | Tantalum | |
| Ta | ⓘ Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series | |
| Ta | ⓘ Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series var. Wolframoixiolite | (Nb,W,Ta,Fe,Mn)2O4 |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series var. Wolframoixiolite | (Nb,W,Ta,Fe,Mn)2O4 |
| Pb | Lead | |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Galena | PbS |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| U | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Uraninite | UO2 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://cs.wikipedia.org/wiki/Doln%C3%AD_Bory |
|---|---|
| Wikidata ID: | Q11815298 |
Localities in this Region
- Vysočina Region
- Žďár nad Sázavou District
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Dolní Bory, Bory, Žďár nad Sázavou District, Vysočina Region, Czech Republic