Log In
Hingston Down Quarry, Gunnislake, Calstock, Cornwall, England, UKi
| Regional Level Types | |
|---|---|
| Hingston Down Quarry | Quarry (Active) |
| Gunnislake | Village |
| Calstock | Civil Parish |
| Cornwall | County |
| England | Constituent Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
50° 31' 27'' North , 4° 14' 40'' West
Latitude & Longitude (decimal):
UK National Grid Reference:
SX409719
Type:
Quarry (Active) - last checked 2019
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Gunnislake | 4,044 (2017) | 2.2km |
| Calstock | 790 (2017) | 4.1km |
| Callington | 5,786 (2017) | 5.5km |
| Bere Alston | 2,164 (2018) | 6.1km |
| Lamerton | 859 (2018) | 6.5km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| British Micromount Society, Devon and Cornwall Branch Meetings | Liskeard, Cornwall | 17km |
This quarry, that lies approximately 1.5 km to the west-north-west of Gunnislake works a fine-grained granite comprising one of the smaller plutons associated with the Cornubian batholith.
As the quarry has extended in a southerly direction it has cut through the lodes and workings of Hingston Downs Consols Mine.
As the quarry has extended in a southerly direction it has cut through the lodes and workings of Hingston Downs Consols Mine.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
65 valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Anatase Formula: TiO2 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Arsenopyrite Formula: FeAsS References: Golley, Peter, Williams, Richard (1995) Cornish Mineral Reference Manual. Endsleigh Book Co., Truro. 71pp. |
| ⓘ Arthurite Formula: CuFe3+2(AsO4)2(OH)2 · 4H2O |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 |
| ⓘ Beudantite Formula: PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bismutoferrite Formula: Fe3+2Bi(SiO4)2(OH) |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 References: |
| ⓘ Brookite Formula: TiO2 |
| ⓘ Calcite Formula: CaCO3 References: |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcophyllite Formula: Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O References: |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ 'Chamosite-Clinochlore Series' |
| ⓘ Formula: CaCu(AsO4)(OH) |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O |
| ⓘ Cyanotrichite Formula: Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O References: |
| ⓘ Enargite Formula: Cu3AsS4 References: |
| ⓘ Ferberite Formula: FeWO4 |
| ⓘ Ferrimolybdite Formula: Fe2(MoO4)3 · nH2O |
| ⓘ Ferrokësterite Formula: Cu2FeSnS4 |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Galena Formula: PbS |
| ⓘ Goethite Formula: Fe3+O(OH) References: P,D, Trebilcock collection.Identified by Peter Trebilcock: Visual Identification |
| ⓘ Hübnerite Formula: MnWO4 |
| ⓘ Hydrokenoelsmoreite Formula: ◻2W2O6(H2O) |
| ⓘ Hydrokenoelsmoreite var. Ferritungstite Formula: ◻2(W,Fe3+)2(O,OH)6(H2O) |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Jeanbandyite Formula: Fe3+Sn(OH)5O |
| ⓘ Kësterite Formula: Cu2ZnSnS4 |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O References: |
| ⓘ Likasite Formula: Cu3(NO3)(OH)5 · 2H2O Description: Probably anthropogenic, due to the use of explosives from which nitrate derives (Weiss et al., 2007). |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Mawsonite Formula: Cu6Fe2SnS8 |
| ⓘ Metatorbernite Formula: Cu(UO2)2(PO4)2 · 8H2O References: |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Mpororoite Formula: WAlO3(OH)3 · 2(H2O) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Natanite Formula: Fe2+[Sn(OH)6] |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu |
| ⓘ Olivenite Formula: Cu2(AsO4)(OH) |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Raspite Formula: Pb(WO4) |
| ⓘ 'Roméite Group' Formula: A2(Sb5+)2O6Z |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 References: |
| ⓘ Russellite Formula: Bi2WO6 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Siderite Formula: FeCO3 References: |
| ⓘ Sphalerite Formula: ZnS References: |
| ⓘ Stannite Formula: Cu2FeSnS4 |
| ⓘ Stannoidite Formula: Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Stolzite Formula: Pb(WO4) Habit: Tabular Colour: Buff References: |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ Tenorite Formula: CuO |
| ⓘ Varlamoffite Formula: Sn1-xFexO2-x(OH) |
| ⓘ Wavellite Formula: Al3(PO4)2(OH)3 · 5H2O |
| ⓘ Wittichenite Formula: Cu3BiS3 |
| ⓘ 'Wolframite Group' |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Ferrokësterite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Kësterite | 2.CB.15a | Cu2ZnSnS4 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Stannoidite | 2.CB.15c | Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 |
| ⓘ | Mawsonite | 2.CB.20 | Cu6Fe2SnS8 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | 4.AA.10 | Cu2O | |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Varlamoffite | 4.DB.05 | Sn1-xFexO2-x(OH) |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | Hübnerite | 4.DB.30 | MnWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Russellite | 4.DE.15 | Bi2WO6 |
| ⓘ | Raspite | 4.DG.20 | Pb(WO4) |
| ⓘ | 'Roméite Group' | 4.DH. | A2(Sb5+)2O6Z |
| ⓘ | Hydrokenoelsmoreite var. Ferritungstite | 4.DH.15 | ◻2(W,Fe3+)2(O,OH)6(H2O) |
| ⓘ | 4.DH.15 | ◻2W2O6(H2O) | |
| ⓘ | Natanite | 4.FC.10 | Fe2+[Sn(OH)6] |
| ⓘ | Jeanbandyite | 4.FC.15 | Fe3+Sn(OH)5O |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Likasite | 5.ND.05 | Cu3(NO3)(OH)5 · 2H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Cyanotrichite | 7.DE.10 | Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Stolzite | 7.GA.05 | Pb(WO4) |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| ⓘ | Mpororoite | 7.GB.35 | WAlO3(OH)3 · 2(H2O) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Conichalcite ? | 8.BH.35 | CaCu(AsO4)(OH) |
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Arthurite | 8.DC.15 | CuFe3+2(AsO4)2(OH)2 · 4H2O |
| ⓘ | Wavellite | 8.DC.50 | Al3(PO4)2(OH)3 · 5H2O |
| ⓘ | Chalcophyllite | 8.DF.30 | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Bismutoferrite | 9.ED.25 | Fe3+2Bi(SiO4)2(OH) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Chamosite-Clinochlore Series' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| H | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| H | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Hydrokenoelsmoreite var. Ferritungstite | ◻2(W,Fe3+)2(O,OH)6(H2O) |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Jeanbandyite | Fe3+Sn(OH)5O |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Likasite | Cu3(NO3)(OH)5 · 2H2O |
| H | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | ⓘ Mpororoite | WAlO3(OH)3 · 2(H2O) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Natanite | Fe2+[Sn(OH)6] |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Varlamoffite | Sn1-xFexO2-x(OH) |
| H | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| H | ⓘ Chamosite-Clinochlore Series | |
| H | ⓘ Hydrokenoelsmoreite | ◻2W2O6(H2O) |
| Be | Beryllium | |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| N | Nitrogen | |
| N | ⓘ Likasite | Cu3(NO3)(OH)5 · 2H2O |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| O | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Hydrokenoelsmoreite var. Ferritungstite | ◻2(W,Fe3+)2(O,OH)6(H2O) |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Jeanbandyite | Fe3+Sn(OH)5O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Likasite | Cu3(NO3)(OH)5 · 2H2O |
| O | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Mpororoite | WAlO3(OH)3 · 2(H2O) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Natanite | Fe2+[Sn(OH)6] |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Raspite | Pb(WO4) |
| O | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Russellite | Bi2WO6 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Varlamoffite | Sn1-xFexO2-x(OH) |
| O | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| O | ⓘ Chamosite-Clinochlore Series | |
| O | ⓘ Hydrokenoelsmoreite | ◻2W2O6(H2O) |
| O | ⓘ Apatite | Ca5(PO4)3A |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Chamosite-Clinochlore Series | |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Al | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Al | ⓘ Mpororoite | WAlO3(OH)3 · 2(H2O) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| Al | ⓘ Chamosite-Clinochlore Series | |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Chamosite-Clinochlore Series | |
| P | Phosphorus | |
| P | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| S | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Ferrokësterite | Cu2FeSnS4 |
| S | ⓘ Galena | PbS |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Kësterite | Cu2ZnSnS4 |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Mawsonite | Cu6Fe2SnS8 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Wittichenite | Cu3BiS3 |
| Cl | Chlorine | |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| K | Potassium | |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Brookite | TiO2 |
| Mn | Manganese | |
| Mn | ⓘ Hübnerite | MnWO4 |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Hydrokenoelsmoreite var. Ferritungstite | ◻2(W,Fe3+)2(O,OH)6(H2O) |
| Fe | ⓘ Ferrokësterite | Cu2FeSnS4 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Jeanbandyite | Fe3+Sn(OH)5O |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Fe | ⓘ Natanite | Fe2+[Sn(OH)6] |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Fe | ⓘ Varlamoffite | Sn1-xFexO2-x(OH) |
| Fe | ⓘ Chamosite-Clinochlore Series | |
| Cu | Copper | |
| Cu | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Cu | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Ferrokësterite | Cu2FeSnS4 |
| Cu | ⓘ Kësterite | Cu2ZnSnS4 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Likasite | Cu3(NO3)(OH)5 · 2H2O |
| Cu | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Cu | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Zn | Zinc | |
| Zn | ⓘ Kësterite | Cu2ZnSnS4 |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| As | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Molybdenite | MoS2 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Ferrokësterite | Cu2FeSnS4 |
| Sn | ⓘ Jeanbandyite | Fe3+Sn(OH)5O |
| Sn | ⓘ Kësterite | Cu2ZnSnS4 |
| Sn | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Sn | ⓘ Natanite | Fe2+[Sn(OH)6] |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Sn | ⓘ Varlamoffite | Sn1-xFexO2-x(OH) |
| Sb | Antimony | |
| Sb | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| Sb | ⓘ Stibnite | Sb2S3 |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Hydrokenoelsmoreite var. Ferritungstite | ◻2(W,Fe3+)2(O,OH)6(H2O) |
| W | ⓘ Hübnerite | MnWO4 |
| W | ⓘ Mpororoite | WAlO3(OH)3 · 2(H2O) |
| W | ⓘ Raspite | Pb(WO4) |
| W | ⓘ Russellite | Bi2WO6 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Stolzite | Pb(WO4) |
| W | ⓘ Hydrokenoelsmoreite | ◻2W2O6(H2O) |
| Pb | Lead | |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Raspite | Pb(WO4) |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Bi | Bismuth | |
| Bi | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Russellite | Bi2WO6 |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| U | Uranium | |
| U | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
Geochronology
| Geologic Time | Rocks, Minerals and Events | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Phanerozoic | ||||||||||||||||||||||
| Paleozoic | ||||||||||||||||||||||
| Permian | ||||||||||||||||||||||
| Guadalupian |
| |||||||||||||||||||||
| Cisuralian |
| |||||||||||||||||||||
Other Regions, Features and Areas containing this locality
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
- Rheno-Hercynian BeltOrogenic Belt
EuropeContinent
UK
- England
- Callington and Tavistock Mining DistrictMining District
- Cornubian mining districtMining District
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Hingston Down Quarry, Gunnislake, Calstock, Cornwall, England, UK